C27H30F3NO2S — CID 143575625
tert-butyl 5-[(3Z,5Z)-7,7,7-trifluoro-6-methyl-5-phenyl-3-sulfanylhepta-3,5-dienyl]-2,3-dihydroindole-1-carboxylate (PubChem CID 143575625) has the molecular formula C27H30F3NO2S and a molecular weight of 489.60 g/mol. Its IUPAC name is tert-butyl 5-[(3Z,5Z)-7,7,7-trifluoro-6-methyl-5-phenyl-3-sulfanylhepta-3,5-dienyl]-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 5-[(3Z,5Z)-7,7,7-trifluoro-6-methyl-5-phenyl-3-sulfanylhepta-3,5-dienyl]-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 143575625 |
| Molecular Formula | C27H30F3NO2S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | tert-butyl 5-[(3Z,5Z)-7,7,7-trifluoro-6-methyl-5-phenyl-3-sulfanylhepta-3,5-dienyl]-2,3-dihydroindole-1-carboxylate |
| SMILES | C/C(=C(\C=C(/S)CCc1ccc2c(c1)CCN2C(=O)OC(C)(C)C)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C27H30F3NO2S/c1-18(27(28,29)30)23(20-8-6-5-7-9-20)17-22(34)12-10-19-11-13-24-21(16-19)14-15-31(24)25(32)33-26(2,3)4/h5-9,11,13,16-17,34H,10,12,14-15H2,1-4H3/b22-17-,23-18- |
| InChIKey | QPAIAIXOZGZFKR-JUKYZOBSSA-N |
| XLogP | 7.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|