C23H23N3O3 — CID 151395659
1-hydroxy-3-methyl-1-[1-[(3-phenoxyphenyl)methyl]-2,3-dihydroindol-5-yl]urea (PubChem CID 151395659) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-hydroxy-3-methyl-1-[1-[(3-phenoxyphenyl)methyl]-2,3-dihydroindol-5-yl]urea.
| Compound Name | 1-hydroxy-3-methyl-1-[1-[(3-phenoxyphenyl)methyl]-2,3-dihydroindol-5-yl]urea |
|---|---|
| PubChem CID | 151395659 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-hydroxy-3-methyl-1-[1-[(3-phenoxyphenyl)methyl]-2,3-dihydroindol-5-yl]urea |
| SMILES | CNC(=O)N(O)c1ccc2c(c1)CCN2Cc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H23N3O3/c1-24-23(27)26(28)19-10-11-22-18(15-19)12-13-25(22)16-17-6-5-9-21(14-17)29-20-7-3-2-4-8-20/h2-11,14-15,28H,12-13,16H2,1H3,(H,24,27) |
| InChIKey | OVJWWRNKIUNFIN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|