C24H24N2O3 — CID 86659867
(1-benzyl-2,3-dihydroindol-5-yl) N-[(4-methoxyphenyl)methyl]carbamate (PubChem CID 86659867) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is (1-benzyl-2,3-dihydroindol-5-yl) N-[(4-methoxyphenyl)methyl]carbamate.
| Compound Name | (1-benzyl-2,3-dihydroindol-5-yl) N-[(4-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 86659867 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (1-benzyl-2,3-dihydroindol-5-yl) N-[(4-methoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CNC(=O)Oc2ccc3c(c2)CCN3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2O3/c1-28-21-9-7-18(8-10-21)16-25-24(27)29-22-11-12-23-20(15-22)13-14-26(23)17-19-5-3-2-4-6-19/h2-12,15H,13-14,16-17H2,1H3,(H,25,27) |
| InChIKey | VCSKCSGPCKYRPD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |