C19H22N2O2 — CID 46865060
(1-benzyl-2,3-dihydroindol-5-yl) N-propylcarbamate (PubChem CID 46865060) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (1-benzyl-2,3-dihydroindol-5-yl) N-propylcarbamate.
| Compound Name | (1-benzyl-2,3-dihydroindol-5-yl) N-propylcarbamate |
|---|---|
| PubChem CID | 46865060 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (1-benzyl-2,3-dihydroindol-5-yl) N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1ccc2c(c1)CCN2Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O2/c1-2-11-20-19(22)23-17-8-9-18-16(13-17)10-12-21(18)14-15-6-4-3-5-7-15/h3-9,13H,2,10-12,14H2,1H3,(H,20,22) |
| InChIKey | FOQPIMDZXXCPMO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |