C26H32N4O3 — CID 118710738
(1-benzyl-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-8-yl) N-heptylcarbamate (PubChem CID 118710738) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is (1-benzyl-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-8-yl) N-heptylcarbamate.
| Compound Name | (1-benzyl-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-8-yl) N-heptylcarbamate |
|---|---|
| PubChem CID | 118710738 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (1-benzyl-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b]quinazolin-8-yl) N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)Oc1ccc2nc3n(c(=O)c2c1)CCCN3Cc1ccccc1 |
| InChI | InChI=1S/C26H32N4O3/c1-2-3-4-5-9-15-27-26(32)33-21-13-14-23-22(18-21)24(31)30-17-10-16-29(25(30)28-23)19-20-11-7-6-8-12-20/h6-8,11-14,18H,2-5,9-10,15-17,19H2,1H3,(H,27,32) |
| InChIKey | ULAYCSDZXUIYAF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|