About quinolin-6-yl N-hexylcarbamate
quinolin-6-yl N-hexylcarbamate (PubChem CID 11587138) has the molecular formula C16H20N2O2
and a molecular weight of 272.35 g/mol. Its IUPAC name is quinolin-6-yl N-hexylcarbamate.
Molecular Properties
| Compound Name | quinolin-6-yl N-hexylcarbamate |
| PubChem CID | 11587138 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | quinolin-6-yl N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)Oc1ccc2ncccc2c1 |
| InChI | InChI=1S/C16H20N2O2/c1-2-3-4-5-10-18-16(19)20-14-8-9-15-13(12-14)7-6-11-17-15/h6-9,11-12H,2-5,10H2,1H3,(H,18,19) |
| InChIKey | RZHZJLAPZGYKLY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze quinolin-6-yl N-hexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-6-yl N-hexylcarbamate?
The IUPAC name of quinolin-6-yl N-hexylcarbamate (CID 11587138) is quinolin-6-yl N-hexylcarbamate.
What is the SMILES notation for quinolin-6-yl N-hexylcarbamate?
The canonical SMILES for quinolin-6-yl N-hexylcarbamate is CCCCCCNC(=O)Oc1ccc2ncccc2c1.
What is the InChIKey of quinolin-6-yl N-hexylcarbamate?
The InChIKey is RZHZJLAPZGYKLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2/c1-2-3-4-5-10-18-16(19)20-14-8-9-15-13(12-14)7-6-11-17-15/h6-9,11-12H,2-5,10H2,1H3,(H,18,19).
What are the key properties of quinolin-6-yl N-hexylcarbamate?
quinolin-6-yl N-hexylcarbamate has a molecular weight of 272.35 g/mol, XLogP of 3.90, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-6-yl N-hexylcarbamate is sourced from PubChem (CID 11587138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).