C21H28N2O2 — CID 146404459
[4-(dimethylamino)-3-phenylphenyl] N-hexylcarbamate (PubChem CID 146404459) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is [4-(dimethylamino)-3-phenylphenyl] N-hexylcarbamate.
| Compound Name | [4-(dimethylamino)-3-phenylphenyl] N-hexylcarbamate |
|---|---|
| PubChem CID | 146404459 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | [4-(dimethylamino)-3-phenylphenyl] N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)Oc1ccc(N(C)C)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C21H28N2O2/c1-4-5-6-10-15-22-21(24)25-18-13-14-20(23(2)3)19(16-18)17-11-8-7-9-12-17/h7-9,11-14,16H,4-6,10,15H2,1-3H3,(H,22,24) |
| InChIKey | LQXIVABZYFRSJA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|