C32H32N2O4 — CID 66879164
(2-phenylphenyl) N-[6-[(2-phenylphenoxy)carbonylamino]hexyl]carbamate (PubChem CID 66879164) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is (2-phenylphenyl) N-[6-[(2-phenylphenoxy)carbonylamino]hexyl]carbamate.
| Compound Name | (2-phenylphenyl) N-[6-[(2-phenylphenoxy)carbonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 66879164 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (2-phenylphenyl) N-[6-[(2-phenylphenoxy)carbonylamino]hexyl]carbamate |
| SMILES | O=C(NCCCCCCNC(=O)Oc1ccccc1-c1ccccc1)Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C32H32N2O4/c35-31(37-29-21-11-9-19-27(29)25-15-5-3-6-16-25)33-23-13-1-2-14-24-34-32(36)38-30-22-12-10-20-28(30)26-17-7-4-8-18-26/h3-12,15-22H,1-2,13-14,23-24H2,(H,33,35)(H,34,36) |
| InChIKey | LPKISQUMSDGBFG-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|