C23H20ClNO4 — CID 166572523
methyl 2-[2-(4-chloro-2-phenylphenyl)ethylcarbamoyloxy]benzoate (PubChem CID 166572523) has the molecular formula C23H20ClNO4 and a molecular weight of 409.87 g/mol. Its IUPAC name is methyl 2-[2-(4-chloro-2-phenylphenyl)ethylcarbamoyloxy]benzoate.
| Compound Name | methyl 2-[2-(4-chloro-2-phenylphenyl)ethylcarbamoyloxy]benzoate |
|---|---|
| PubChem CID | 166572523 |
| Molecular Formula | C23H20ClNO4 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | methyl 2-[2-(4-chloro-2-phenylphenyl)ethylcarbamoyloxy]benzoate |
| SMILES | COC(=O)c1ccccc1OC(=O)NCCc1ccc(Cl)cc1-c1ccccc1 |
| InChI | InChI=1S/C23H20ClNO4/c1-28-22(26)19-9-5-6-10-21(19)29-23(27)25-14-13-17-11-12-18(24)15-20(17)16-7-3-2-4-8-16/h2-12,15H,13-14H2,1H3,(H,25,27) |
| InChIKey | JPNVAXBZBVJDJO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |