C10H12ClNO3 — CID 115171089
2-(5-chloro-2-methoxyphenyl)ethylcarbamic acid (PubChem CID 115171089) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)ethylcarbamic acid.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)ethylcarbamic acid |
|---|---|
| PubChem CID | 115171089 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)ethylcarbamic acid |
| SMILES | COc1ccc(Cl)cc1CCNC(=O)O |
| InChI | InChI=1S/C10H12ClNO3/c1-15-9-3-2-8(11)6-7(9)4-5-12-10(13)14/h2-3,6,12H,4-5H2,1H3,(H,13,14) |
| InChIKey | ATVADCJZWOAUHF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |