C11H15N3O3S — CID 18622048
2-[5-(carbamothioylamino)-2-methoxyphenyl]ethylcarbamic acid (PubChem CID 18622048) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-[5-(carbamothioylamino)-2-methoxyphenyl]ethylcarbamic acid.
| Compound Name | 2-[5-(carbamothioylamino)-2-methoxyphenyl]ethylcarbamic acid |
|---|---|
| PubChem CID | 18622048 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-[5-(carbamothioylamino)-2-methoxyphenyl]ethylcarbamic acid |
| SMILES | COc1ccc(NC(N)=S)cc1CCNC(=O)O |
| InChI | InChI=1S/C11H15N3O3S/c1-17-9-3-2-8(14-10(12)18)6-7(9)4-5-13-11(15)16/h2-3,6,13H,4-5H2,1H3,(H,15,16)(H3,12,14,18) |
| InChIKey | NLTNGMNJTDJBGY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|