C14H17ClF3NO5 — CID 139017041
3-[2-(5-chloro-2-methoxyphenyl)ethylamino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 139017041) has the molecular formula C14H17ClF3NO5 and a molecular weight of 371.74 g/mol. Its IUPAC name is 3-[2-(5-chloro-2-methoxyphenyl)ethylamino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-(5-chloro-2-methoxyphenyl)ethylamino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 139017041 |
| Molecular Formula | C14H17ClF3NO5 |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 3-[2-(5-chloro-2-methoxyphenyl)ethylamino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(Cl)cc1CCNCCC(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H16ClNO3.C2HF3O2/c1-17-11-3-2-10(13)8-9(11)4-6-14-7-5-12(15)16;3-2(4,5)1(6)7/h2-3,8,14H,4-7H2,1H3,(H,15,16);(H,6,7) |
| InChIKey | JRRDNZAFICDABZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|