C21H23FNO4- — CID 144567354
2-[3-fluoro-4-[3-(hexylcarbamoyloxy)phenyl]phenyl]acetate (PubChem CID 144567354) has the molecular formula C21H23FNO4- and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[3-fluoro-4-[3-(hexylcarbamoyloxy)phenyl]phenyl]acetate.
| Compound Name | 2-[3-fluoro-4-[3-(hexylcarbamoyloxy)phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 144567354 |
| Molecular Formula | C21H23FNO4- |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[3-fluoro-4-[3-(hexylcarbamoyloxy)phenyl]phenyl]acetate |
| SMILES | CCCCCCNC(=O)Oc1cccc(-c2ccc(CC(=O)[O-])cc2F)c1 |
| InChI | InChI=1S/C21H24FNO4/c1-2-3-4-5-11-23-21(26)27-17-8-6-7-16(14-17)18-10-9-15(12-19(18)22)13-20(24)25/h6-10,12,14H,2-5,11,13H2,1H3,(H,23,26)(H,24,25)/p-1 |
| InChIKey | AWXIYEGJBOAMER-UHFFFAOYSA-M |
| XLogP | 3.45 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|