C24H29FN2O3 — CID 11575170
(E)-3-[3-fluoro-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]prop-2-enoic acid (PubChem CID 11575170) has the molecular formula C24H29FN2O3 and a molecular weight of 412.51 g/mol. Its IUPAC name is (E)-3-[3-fluoro-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11575170 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (E)-3-[3-fluoro-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]prop-2-enoic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(/C=C/C(=O)O)cc2F)c1 |
| InChI | InChI=1S/C24H29FN2O3/c1-3-4-5-6-7-15-26-24(30)27(2)20-10-8-9-19(17-20)21-13-11-18(16-22(21)25)12-14-23(28)29/h8-14,16-17H,3-7,15H2,1-2H3,(H,26,30)(H,28,29)/b14-12+ |
| InChIKey | UEBGMESCFDJNIO-WYMLVPIESA-N |
| XLogP | 5.71 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|