C28H38N2O5 — CID 90763161
methyl 3-[3-butoxy-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]-2-methoxyprop-2-enoate (PubChem CID 90763161) has the molecular formula C28H38N2O5 and a molecular weight of 482.62 g/mol. Its IUPAC name is methyl 3-[3-butoxy-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]-2-methoxyprop-2-enoate.
| Compound Name | methyl 3-[3-butoxy-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]-2-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 90763161 |
| Molecular Formula | C28H38N2O5 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | methyl 3-[3-butoxy-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]-2-methoxyprop-2-enoate |
| SMILES | CCCCCNC(=O)N(C)c1cccc(-c2ccc(C=C(OC)C(=O)OC)cc2OCCCC)c1 |
| InChI | InChI=1S/C28H38N2O5/c1-6-8-10-16-29-28(32)30(3)23-13-11-12-22(20-23)24-15-14-21(18-25(24)35-17-9-7-2)19-26(33-4)27(31)34-5/h11-15,18-20H,6-10,16-17H2,1-5H3,(H,29,32) |
| InChIKey | YWGFLBHMEZXPLN-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|