C27H36N2O5 — CID 68961361
(Z)-3-[3-(2-ethoxyethoxy)-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 68961361) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is (Z)-3-[3-(2-ethoxyethoxy)-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (Z)-3-[3-(2-ethoxyethoxy)-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 68961361 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | (Z)-3-[3-(2-ethoxyethoxy)-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCNC(=O)N(C)c1cccc(-c2ccc(/C=C(/C)C(=O)O)cc2OCCOCC)c1 |
| InChI | InChI=1S/C27H36N2O5/c1-5-7-8-14-28-27(32)29(4)23-11-9-10-22(19-23)24-13-12-21(17-20(3)26(30)31)18-25(24)34-16-15-33-6-2/h9-13,17-19H,5-8,14-16H2,1-4H3,(H,28,32)(H,30,31)/b20-17- |
| InChIKey | SUHCOOJQXXWVMQ-JZJYNLBNSA-N |
| XLogP | 5.59 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|