C25H33N3O4 — CID 68957109
(E)-2-ethoxy-3-[6-[3-[heptylcarbamoyl(methyl)amino]phenyl]-3-pyridinyl]prop-2-enoic acid (PubChem CID 68957109) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is (E)-2-ethoxy-3-[6-[3-[heptylcarbamoyl(methyl)amino]phenyl]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-2-ethoxy-3-[6-[3-[heptylcarbamoyl(methyl)amino]phenyl]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68957109 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | (E)-2-ethoxy-3-[6-[3-[heptylcarbamoyl(methyl)amino]phenyl]-3-pyridinyl]prop-2-enoic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(/C=C(/OCC)C(=O)O)cn2)c1 |
| InChI | InChI=1S/C25H33N3O4/c1-4-6-7-8-9-15-26-25(31)28(3)21-12-10-11-20(17-21)22-14-13-19(18-27-22)16-23(24(29)30)32-5-2/h10-14,16-18H,4-9,15H2,1-3H3,(H,26,31)(H,29,30)/b23-16+ |
| InChIKey | SGMLWSLIHQOJAU-XQNSMLJCSA-N |
| XLogP | 5.33 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|