C27H36N2O3 — CID 68964090
ethyl (2E)-2-[[4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]methylidene]pentanoate (PubChem CID 68964090) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is ethyl (2E)-2-[[4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]methylidene]pentanoate.
| Compound Name | ethyl (2E)-2-[[4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]methylidene]pentanoate |
|---|---|
| PubChem CID | 68964090 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | ethyl (2E)-2-[[4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]methylidene]pentanoate |
| SMILES | CCCCCNC(=O)N(C)c1cccc(-c2ccc(/C=C(\CCC)C(=O)OCC)cc2)c1 |
| InChI | InChI=1S/C27H36N2O3/c1-5-8-9-18-28-27(31)29(4)25-13-10-12-23(20-25)22-16-14-21(15-17-22)19-24(11-6-2)26(30)32-7-3/h10,12-17,19-20H,5-9,11,18H2,1-4H3,(H,28,31)/b24-19+ |
| InChIKey | DUWVWYFDWKXDSA-LYBHJNIJSA-N |
| XLogP | 6.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|