C30H44N6O6 — CID 159107043
(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoate;(Z)-2-ethoxy-3-[4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]prop-2-enoate (PubChem CID 159107043) has the molecular formula C30H44N6O6 and a molecular weight of 584.72 g/mol. Its IUPAC name is (2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoate;(Z)-2-ethoxy-3-[4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]prop-2-enoate.
| Compound Name | (2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoate;(Z)-2-ethoxy-3-[4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 159107043 |
| Molecular Formula | C30H44N6O6 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | (2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoate;(Z)-2-ethoxy-3-[4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]prop-2-enoate |
| SMILES | CCCCCNC(=O)N(C)c1cccc(-c2ccc(/C=C(\OCC)C(=O)[O-])cc2)c1.NC(N)=[NH+]CCC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C24H30N2O4.C6H14N4O2/c1-4-6-7-15-25-24(29)26(3)21-10-8-9-20(17-21)19-13-11-18(12-14-19)16-22(23(27)28)30-5-2;7-4(5(11)12)2-1-3-10-6(8)9/h8-14,16-17H,4-7,15H2,1-3H3,(H,25,29)(H,27,28);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/b22-16-;/t;4-/m.0/s1 |
| InChIKey | KEABPOBDIBEYMZ-WTYWOCJDSA-N |
| XLogP | -1.70 |
| TPSA | 215.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|