C27H36N2O4 — CID 67304404
3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-prop-2-enoxypropanoic acid (PubChem CID 67304404) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is 3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-prop-2-enoxypropanoic acid.
| Compound Name | 3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-prop-2-enoxypropanoic acid |
|---|---|
| PubChem CID | 67304404 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-prop-2-enoxypropanoic acid |
| SMILES | C=CCOC(Cc1ccc(-c2cccc(N(C)C(=O)NCCCCCCC)c2)cc1)C(=O)O |
| InChI | InChI=1S/C27H36N2O4/c1-4-6-7-8-9-17-28-27(32)29(3)24-12-10-11-23(20-24)22-15-13-21(14-16-22)19-25(26(30)31)33-18-5-2/h5,10-16,20,25H,2,4,6-9,17-19H2,1,3H3,(H,28,32)(H,30,31) |
| InChIKey | VVTDIKNOGJMRSI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|