C32H40N2O4 — CID 67304752
methyl (2S)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-phenylmethoxypropanoate (PubChem CID 67304752) has the molecular formula C32H40N2O4 and a molecular weight of 516.68 g/mol. Its IUPAC name is methyl (2S)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-phenylmethoxypropanoate.
| Compound Name | methyl (2S)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 67304752 |
| Molecular Formula | C32H40N2O4 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | methyl (2S)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-phenylmethoxypropanoate |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(C[C@H](OCc3ccccc3)C(=O)OC)cc2)c1 |
| InChI | InChI=1S/C32H40N2O4/c1-4-5-6-7-11-21-33-32(36)34(2)29-16-12-15-28(23-29)27-19-17-25(18-20-27)22-30(31(35)37-3)38-24-26-13-9-8-10-14-26/h8-10,12-20,23,30H,4-7,11,21-22,24H2,1-3H3,(H,33,36)/t30-/m0/s1 |
| InChIKey | YCEFGWUZGFEDLJ-PMERELPUSA-N |
| XLogP | 6.77 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|