C26H37N3O3 — CID 68643303
(2S)-2-(ethylamino)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoic acid (PubChem CID 68643303) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is (2S)-2-(ethylamino)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-(ethylamino)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 68643303 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | (2S)-2-(ethylamino)-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(C[C@H](NCC)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C26H37N3O3/c1-4-6-7-8-9-17-28-26(32)29(3)23-12-10-11-22(19-23)21-15-13-20(14-16-21)18-24(25(30)31)27-5-2/h10-16,19,24,27H,4-9,17-18H2,1-3H3,(H,28,32)(H,30,31)/t24-/m0/s1 |
| InChIKey | IKHPQIMAKVPRJB-DEOSSOPVSA-N |
| XLogP | 5.07 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|