C51H54N4O3 — CID 10010407
(2S)-2-(2-benzoylanilino)-N,N-dibenzyl-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanamide (PubChem CID 10010407) has the molecular formula C51H54N4O3 and a molecular weight of 771.02 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-N,N-dibenzyl-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanamide.
| Compound Name | (2S)-2-(2-benzoylanilino)-N,N-dibenzyl-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanamide |
|---|---|
| PubChem CID | 10010407 |
| Molecular Formula | C51H54N4O3 |
| Molecular Weight | 771.02 g/mol |
| Exact Mass | 770.42 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-N,N-dibenzyl-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanamide |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(C[C@H](Nc3ccccc3C(=O)c3ccccc3)C(=O)N(Cc3ccccc3)Cc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C51H54N4O3/c1-3-4-5-6-18-34-52-51(58)54(2)45-27-19-26-44(36-45)42-32-30-39(31-33-42)35-48(53-47-29-17-16-28-46(47)49(56)43-24-14-9-15-25-43)50(57)55(37-40-20-10-7-11-21-40)38-41-22-12-8-13-23-41/h7-17,19-33,36,48,53H,3-6,18,34-35,37-38H2,1-2H3,(H,52,58)/t48-/m0/s1 |
| InChIKey | AQYMPRHAGMBJMJ-DYVQZXGMSA-N |
| XLogP | 10.95 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.02 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|