C39H44N2O5 — CID 69125760
methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(hexanoyl)amino]propoxy]phenyl]propanoate (PubChem CID 69125760) has the molecular formula C39H44N2O5 and a molecular weight of 620.79 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(hexanoyl)amino]propoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(hexanoyl)amino]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69125760 |
| Molecular Formula | C39H44N2O5 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(hexanoyl)amino]propoxy]phenyl]propanoate |
| SMILES | CCCCCC(=O)N(CCCOc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)OC)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C39H44N2O5/c1-3-4-7-21-37(42)41(29-31-15-8-5-9-16-31)26-14-27-46-33-24-22-30(23-25-33)28-36(39(44)45-2)40-35-20-13-12-19-34(35)38(43)32-17-10-6-11-18-32/h5-6,8-13,15-20,22-25,36,40H,3-4,7,14,21,26-29H2,1-2H3/t36-/m0/s1 |
| InChIKey | YXOQTEGJOYBYGR-BHVANESWSA-N |
| XLogP | 7.49 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|