C38H42N2O5 — CID 69168342
(2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(2-ethylbutanoyl)amino]propoxy]phenyl]propanoic acid (PubChem CID 69168342) has the molecular formula C38H42N2O5 and a molecular weight of 606.76 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(2-ethylbutanoyl)amino]propoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(2-ethylbutanoyl)amino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69168342 |
| Molecular Formula | C38H42N2O5 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl(2-ethylbutanoyl)amino]propoxy]phenyl]propanoic acid |
| SMILES | CCC(CC)C(=O)N(CCCOc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C38H42N2O5/c1-3-30(4-2)37(42)40(27-29-14-7-5-8-15-29)24-13-25-45-32-22-20-28(21-23-32)26-35(38(43)44)39-34-19-12-11-18-33(34)36(41)31-16-9-6-10-17-31/h5-12,14-23,30,35,39H,3-4,13,24-27H2,1-2H3,(H,43,44)/t35-/m0/s1 |
| InChIKey | RNHWKEIUAQXICS-DHUJRADRSA-N |
| XLogP | 7.26 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|