C39H36N2O6 — CID 69141756
(2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl-[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propoxy]phenyl]propanoic acid (PubChem CID 69141756) has the molecular formula C39H36N2O6 and a molecular weight of 628.73 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl-[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl-[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69141756 |
| Molecular Formula | C39H36N2O6 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl-[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propoxy]phenyl]propanoic acid |
| SMILES | O=C(c1ccccc1)c1ccccc1N[C@@H](Cc1ccc(OCCCN(Cc2ccccc2)C(=O)/C=C/c2ccco2)cc1)C(=O)O |
| InChI | InChI=1S/C39H36N2O6/c42-37(23-22-32-15-9-25-46-32)41(28-30-11-3-1-4-12-30)24-10-26-47-33-20-18-29(19-21-33)27-36(39(44)45)40-35-17-8-7-16-34(35)38(43)31-13-5-2-6-14-31/h1-9,11-23,25,36,40H,10,24,26-28H2,(H,44,45)/b23-22+/t36-/m0/s1 |
| InChIKey | JGCBZEYEMWBDIC-XJFXDDNPSA-N |
| XLogP | 7.13 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|