C40H38N2O6 — CID 69126730
methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl-[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propoxy]phenyl]propanoate (PubChem CID 69126730) has the molecular formula C40H38N2O6 and a molecular weight of 642.75 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl-[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl-[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69126730 |
| Molecular Formula | C40H38N2O6 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-[benzyl-[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCCN(Cc2ccccc2)C(=O)/C=C/c2ccco2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C40H38N2O6/c1-46-40(45)37(41-36-18-9-8-17-35(36)39(44)32-14-6-3-7-15-32)28-30-19-21-34(22-20-30)48-27-11-25-42(29-31-12-4-2-5-13-31)38(43)24-23-33-16-10-26-47-33/h2-10,12-24,26,37,41H,11,25,27-29H2,1H3/b24-23+/t37-/m0/s1 |
| InChIKey | VEWDWHLYXDUKOE-YTVPAZMRSA-N |
| XLogP | 7.22 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|