C38H42N2O5 — CID 69126490
methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[benzyl(3,3-dimethylbutanoyl)amino]ethoxy]phenyl]propanoate (PubChem CID 69126490) has the molecular formula C38H42N2O5 and a molecular weight of 606.76 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[benzyl(3,3-dimethylbutanoyl)amino]ethoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[benzyl(3,3-dimethylbutanoyl)amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69126490 |
| Molecular Formula | C38H42N2O5 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[benzyl(3,3-dimethylbutanoyl)amino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCN(Cc2ccccc2)C(=O)CC(C)(C)C)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C38H42N2O5/c1-38(2,3)26-35(41)40(27-29-13-7-5-8-14-29)23-24-45-31-21-19-28(20-22-31)25-34(37(43)44-4)39-33-18-12-11-17-32(33)36(42)30-15-9-6-10-16-30/h5-22,34,39H,23-27H2,1-4H3/t34-/m0/s1 |
| InChIKey | BLBTVPMGOLXRGV-UMSFTDKQSA-N |
| XLogP | 6.96 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|