C41H46N2O5 — CID 69127393
methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[benzyl(3-cyclohexylpropanoyl)amino]ethoxy]phenyl]propanoate (PubChem CID 69127393) has the molecular formula C41H46N2O5 and a molecular weight of 646.83 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[benzyl(3-cyclohexylpropanoyl)amino]ethoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[benzyl(3-cyclohexylpropanoyl)amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69127393 |
| Molecular Formula | C41H46N2O5 |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.34 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[benzyl(3-cyclohexylpropanoyl)amino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCN(Cc2ccccc2)C(=O)CCC2CCCCC2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C41H46N2O5/c1-47-41(46)38(42-37-20-12-11-19-36(37)40(45)34-17-9-4-10-18-34)29-32-21-24-35(25-22-32)48-28-27-43(30-33-15-7-3-8-16-33)39(44)26-23-31-13-5-2-6-14-31/h3-4,7-12,15-22,24-25,31,38,42H,2,5-6,13-14,23,26-30H2,1H3/t38-/m0/s1 |
| InChIKey | FSZATIKGRWWBFS-LHEWISCISA-N |
| XLogP | 7.88 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|