C33H35F3N2O5 — CID 87706850
methyl 2-(2-benzoylanilino)-3-[4-[2-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]ethoxy]phenyl]propanoate (PubChem CID 87706850) has the molecular formula C33H35F3N2O5 and a molecular weight of 596.65 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[2-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[2-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 87706850 |
| Molecular Formula | C33H35F3N2O5 |
| Molecular Weight | 596.65 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[2-[cyclohexyl-(2,2,2-trifluoroacetyl)amino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCN(C(=O)C(F)(F)F)C2CCCCC2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C33H35F3N2O5/c1-42-31(40)29(37-28-15-9-8-14-27(28)30(39)24-10-4-2-5-11-24)22-23-16-18-26(19-17-23)43-21-20-38(32(41)33(34,35)36)25-12-6-3-7-13-25/h2,4-5,8-11,14-19,25,29,37H,3,6-7,12-13,20-22H2,1H3 |
| InChIKey | BSHWNEIICVCVAA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.65 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|