C37H34N2O4 — CID 69127076
methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-(N-phenylanilino)ethoxy]phenyl]propanoate (PubChem CID 69127076) has the molecular formula C37H34N2O4 and a molecular weight of 570.69 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-(N-phenylanilino)ethoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-(N-phenylanilino)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69127076 |
| Molecular Formula | C37H34N2O4 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-(N-phenylanilino)ethoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCN(c2ccccc2)c2ccccc2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C37H34N2O4/c1-42-37(41)35(38-34-20-12-11-19-33(34)36(40)29-13-5-2-6-14-29)27-28-21-23-32(24-22-28)43-26-25-39(30-15-7-3-8-16-30)31-17-9-4-10-18-31/h2-24,35,38H,25-27H2,1H3/t35-/m0/s1 |
| InChIKey | CHMXIEYXZHCDLM-DHUJRADRSA-N |
| XLogP | 7.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|