C37H34N2O5 — CID 69127573
(2S)-2-(2-benzoylanilino)-3-[4-[2-(N-(3-methoxyphenyl)anilino)ethoxy]phenyl]propanoic acid (PubChem CID 69127573) has the molecular formula C37H34N2O5 and a molecular weight of 586.69 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[2-(N-(3-methoxyphenyl)anilino)ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-(N-(3-methoxyphenyl)anilino)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127573 |
| Molecular Formula | C37H34N2O5 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-(N-(3-methoxyphenyl)anilino)ethoxy]phenyl]propanoic acid |
| SMILES | COc1cccc(N(CCOc2ccc(C[C@H](Nc3ccccc3C(=O)c3ccccc3)C(=O)O)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C37H34N2O5/c1-43-32-16-10-15-30(26-32)39(29-13-6-3-7-14-29)23-24-44-31-21-19-27(20-22-31)25-35(37(41)42)38-34-18-9-8-17-33(34)36(40)28-11-4-2-5-12-28/h2-22,26,35,38H,23-25H2,1H3,(H,41,42)/t35-/m0/s1 |
| InChIKey | IJOMASULTWPCCW-DHUJRADRSA-N |
| XLogP | 7.25 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|