C36H38N2O6 — CID 69127958
(2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(2,2-dimethylpropanoyl)-3-methoxyanilino]ethoxy]phenyl]propanoic acid (PubChem CID 69127958) has the molecular formula C36H38N2O6 and a molecular weight of 594.71 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(2,2-dimethylpropanoyl)-3-methoxyanilino]ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(2,2-dimethylpropanoyl)-3-methoxyanilino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127958 |
| Molecular Formula | C36H38N2O6 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(2,2-dimethylpropanoyl)-3-methoxyanilino]ethoxy]phenyl]propanoic acid |
| SMILES | COc1cccc(N(CCOc2ccc(C[C@H](Nc3ccccc3C(=O)c3ccccc3)C(=O)O)cc2)C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C36H38N2O6/c1-36(2,3)35(42)38(27-13-10-14-29(24-27)43-4)21-22-44-28-19-17-25(18-20-28)23-32(34(40)41)37-31-16-9-8-15-30(31)33(39)26-11-6-5-7-12-26/h5-20,24,32,37H,21-23H2,1-4H3,(H,40,41)/t32-/m0/s1 |
| InChIKey | OENWCDNJCBOQAR-YTTGMZPUSA-N |
| XLogP | 6.49 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|