C36H37FN2O5 — CID 69126893
methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(2,2-dimethylpropanoyl)-3-fluoroanilino]ethoxy]phenyl]propanoate (PubChem CID 69126893) has the molecular formula C36H37FN2O5 and a molecular weight of 596.70 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(2,2-dimethylpropanoyl)-3-fluoroanilino]ethoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(2,2-dimethylpropanoyl)-3-fluoroanilino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69126893 |
| Molecular Formula | C36H37FN2O5 |
| Molecular Weight | 596.70 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(2,2-dimethylpropanoyl)-3-fluoroanilino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCN(C(=O)C(C)(C)C)c2cccc(F)c2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C36H37FN2O5/c1-36(2,3)35(42)39(28-14-10-13-27(37)24-28)21-22-44-29-19-17-25(18-20-29)23-32(34(41)43-4)38-31-16-9-8-15-30(31)33(40)26-11-6-5-7-12-26/h5-20,24,32,38H,21-23H2,1-4H3/t32-/m0/s1 |
| InChIKey | REOZLWPLADSJDX-YTTGMZPUSA-N |
| XLogP | 6.71 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.70 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|