C37H37ClN2O5 — CID 69127725
methyl 2-(2-benzoylanilino)-3-[4-[2-[3-chloro-N-(cyclopentanecarbonyl)anilino]ethoxy]phenyl]propanoate (PubChem CID 69127725) has the molecular formula C37H37ClN2O5 and a molecular weight of 625.17 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[2-[3-chloro-N-(cyclopentanecarbonyl)anilino]ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[2-[3-chloro-N-(cyclopentanecarbonyl)anilino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69127725 |
| Molecular Formula | C37H37ClN2O5 |
| Molecular Weight | 625.17 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[2-[3-chloro-N-(cyclopentanecarbonyl)anilino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCN(C(=O)C2CCCC2)c2cccc(Cl)c2)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C37H37ClN2O5/c1-44-37(43)34(39-33-17-8-7-16-32(33)35(41)27-10-3-2-4-11-27)24-26-18-20-31(21-19-26)45-23-22-40(30-15-9-14-29(38)25-30)36(42)28-12-5-6-13-28/h2-4,7-11,14-21,25,28,34,39H,5-6,12-13,22-24H2,1H3 |
| InChIKey | HENQIEFLNWGAHP-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.17 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|