C36H35FN2O5 — CID 69168042
(2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(cyclopentanecarbonyl)-2-fluoroanilino]ethoxy]phenyl]propanoic acid (PubChem CID 69168042) has the molecular formula C36H35FN2O5 and a molecular weight of 594.68 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(cyclopentanecarbonyl)-2-fluoroanilino]ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(cyclopentanecarbonyl)-2-fluoroanilino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69168042 |
| Molecular Formula | C36H35FN2O5 |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[N-(cyclopentanecarbonyl)-2-fluoroanilino]ethoxy]phenyl]propanoic acid |
| SMILES | O=C(c1ccccc1)c1ccccc1N[C@@H](Cc1ccc(OCCN(C(=O)C2CCCC2)c2ccccc2F)cc1)C(=O)O |
| InChI | InChI=1S/C36H35FN2O5/c37-30-15-7-9-17-33(30)39(35(41)27-12-4-5-13-27)22-23-44-28-20-18-25(19-21-28)24-32(36(42)43)38-31-16-8-6-14-29(31)34(40)26-10-2-1-3-11-26/h1-3,6-11,14-21,27,32,38H,4-5,12-13,22-24H2,(H,42,43)/t32-/m0/s1 |
| InChIKey | QCQVHIVNWJSFGD-YTTGMZPUSA-N |
| XLogP | 6.77 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|