C39H36N2O5 — CID 69125991
methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[cyclopropanecarbonyl(naphthalen-1-yl)amino]ethoxy]phenyl]propanoate (PubChem CID 69125991) has the molecular formula C39H36N2O5 and a molecular weight of 612.73 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[cyclopropanecarbonyl(naphthalen-1-yl)amino]ethoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[cyclopropanecarbonyl(naphthalen-1-yl)amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69125991 |
| Molecular Formula | C39H36N2O5 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[2-[cyclopropanecarbonyl(naphthalen-1-yl)amino]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OCCN(C(=O)C2CC2)c2cccc3ccccc23)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C39H36N2O5/c1-45-39(44)35(40-34-16-8-7-15-33(34)37(42)29-11-3-2-4-12-29)26-27-18-22-31(23-19-27)46-25-24-41(38(43)30-20-21-30)36-17-9-13-28-10-5-6-14-32(28)36/h2-19,22-23,30,35,40H,20-21,24-26H2,1H3/t35-/m0/s1 |
| InChIKey | ZKFVOGZKXDBCLU-DHUJRADRSA-N |
| XLogP | 7.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|