C34H32N2O6 — CID 69127734
2-(2-benzoylanilino)-3-[4-[2-(2-methoxy-N-prop-2-enoylanilino)ethoxy]phenyl]propanoic acid (PubChem CID 69127734) has the molecular formula C34H32N2O6 and a molecular weight of 564.64 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[2-(2-methoxy-N-prop-2-enoylanilino)ethoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[2-(2-methoxy-N-prop-2-enoylanilino)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127734 |
| Molecular Formula | C34H32N2O6 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[2-(2-methoxy-N-prop-2-enoylanilino)ethoxy]phenyl]propanoic acid |
| SMILES | C=CC(=O)N(CCOc1ccc(CC(Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1)c1ccccc1OC |
| InChI | InChI=1S/C34H32N2O6/c1-3-32(37)36(30-15-9-10-16-31(30)41-2)21-22-42-26-19-17-24(18-20-26)23-29(34(39)40)35-28-14-8-7-13-27(28)33(38)25-11-5-4-6-12-25/h3-20,29,35H,1,21-23H2,2H3,(H,39,40) |
| InChIKey | FHVOWCWWHPITMO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|