C35H34N2O6 — CID 174536386
2-(2-benzoyloxyanilino)-3-[4-[3-(2-methyl-N-prop-2-enoylanilino)propoxy]phenyl]propanoic acid (PubChem CID 174536386) has the molecular formula C35H34N2O6 and a molecular weight of 578.67 g/mol. Its IUPAC name is 2-(2-benzoyloxyanilino)-3-[4-[3-(2-methyl-N-prop-2-enoylanilino)propoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoyloxyanilino)-3-[4-[3-(2-methyl-N-prop-2-enoylanilino)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 174536386 |
| Molecular Formula | C35H34N2O6 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 2-(2-benzoyloxyanilino)-3-[4-[3-(2-methyl-N-prop-2-enoylanilino)propoxy]phenyl]propanoic acid |
| SMILES | C=CC(=O)N(CCCOc1ccc(CC(Nc2ccccc2OC(=O)c2ccccc2)C(=O)O)cc1)c1ccccc1C |
| InChI | InChI=1S/C35H34N2O6/c1-3-33(38)37(31-16-9-7-12-25(31)2)22-11-23-42-28-20-18-26(19-21-28)24-30(34(39)40)36-29-15-8-10-17-32(29)43-35(41)27-13-5-4-6-14-27/h3-10,12-21,30,36H,1,11,22-24H2,2H3,(H,39,40) |
| InChIKey | ULSUTABJRUMYEO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|