C40H40N2O5 — CID 174536406
2-(2-benzoyloxyanilino)-4-[4-[3-(N-benzyl-4-methylanilino)propoxy]phenyl]butanoic acid (PubChem CID 174536406) has the molecular formula C40H40N2O5 and a molecular weight of 628.77 g/mol. Its IUPAC name is 2-(2-benzoyloxyanilino)-4-[4-[3-(N-benzyl-4-methylanilino)propoxy]phenyl]butanoic acid.
| Compound Name | 2-(2-benzoyloxyanilino)-4-[4-[3-(N-benzyl-4-methylanilino)propoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 174536406 |
| Molecular Formula | C40H40N2O5 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | 2-(2-benzoyloxyanilino)-4-[4-[3-(N-benzyl-4-methylanilino)propoxy]phenyl]butanoic acid |
| SMILES | Cc1ccc(N(CCCOc2ccc(CCC(Nc3ccccc3OC(=O)c3ccccc3)C(=O)O)cc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C40H40N2O5/c1-30-17-22-34(23-18-30)42(29-32-11-4-2-5-12-32)27-10-28-46-35-24-19-31(20-25-35)21-26-37(39(43)44)41-36-15-8-9-16-38(36)47-40(45)33-13-6-3-7-14-33/h2-9,11-20,22-25,37,41H,10,21,26-29H2,1H3,(H,43,44) |
| InChIKey | LFDMEACFRSUDJJ-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|