C37H40N2O5 — CID 69127618
(2S)-2-(2-benzoylanilino)-3-[4-[3-(3-methyl-N-pentanoylanilino)propoxy]phenyl]propanoic acid (PubChem CID 69127618) has the molecular formula C37H40N2O5 and a molecular weight of 592.74 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[3-(3-methyl-N-pentanoylanilino)propoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-(3-methyl-N-pentanoylanilino)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127618 |
| Molecular Formula | C37H40N2O5 |
| Molecular Weight | 592.74 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-(3-methyl-N-pentanoylanilino)propoxy]phenyl]propanoic acid |
| SMILES | CCCCC(=O)N(CCCOc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C37H40N2O5/c1-3-4-18-35(40)39(30-15-10-12-27(2)25-30)23-11-24-44-31-21-19-28(20-22-31)26-34(37(42)43)38-33-17-9-8-16-32(33)36(41)29-13-6-5-7-14-29/h5-10,12-17,19-22,25,34,38H,3-4,11,18,23-24,26H2,1-2H3,(H,42,43)/t34-/m0/s1 |
| InChIKey | KZBFVZVPZKYIHU-UMSFTDKQSA-N |
| XLogP | 7.33 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.74 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|