C35H36N2O5S — CID 69127298
2-(2-benzoylanilino)-3-[4-[2-(N-butanoyl-4-methylsulfanylanilino)ethoxy]phenyl]propanoic acid (PubChem CID 69127298) has the molecular formula C35H36N2O5S and a molecular weight of 596.75 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[2-(N-butanoyl-4-methylsulfanylanilino)ethoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[2-(N-butanoyl-4-methylsulfanylanilino)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127298 |
| Molecular Formula | C35H36N2O5S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[2-(N-butanoyl-4-methylsulfanylanilino)ethoxy]phenyl]propanoic acid |
| SMILES | CCCC(=O)N(CCOc1ccc(CC(Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1)c1ccc(SC)cc1 |
| InChI | InChI=1S/C35H36N2O5S/c1-3-9-33(38)37(27-16-20-29(43-2)21-17-27)22-23-42-28-18-14-25(15-19-28)24-32(35(40)41)36-31-13-8-7-12-30(31)34(39)26-10-5-4-6-11-26/h4-8,10-21,32,36H,3,9,22-24H2,1-2H3,(H,40,41) |
| InChIKey | ZFHNOXNPJZVRHT-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|