C36H37ClN2O5 — CID 69128256
methyl 2-(2-benzoylanilino)-3-[4-[3-(N-butanoyl-4-chloroanilino)propoxy]phenyl]propanoate (PubChem CID 69128256) has the molecular formula C36H37ClN2O5 and a molecular weight of 613.15 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[3-(N-butanoyl-4-chloroanilino)propoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[3-(N-butanoyl-4-chloroanilino)propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69128256 |
| Molecular Formula | C36H37ClN2O5 |
| Molecular Weight | 613.15 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[3-(N-butanoyl-4-chloroanilino)propoxy]phenyl]propanoate |
| SMILES | CCCC(=O)N(CCCOc1ccc(CC(Nc2ccccc2C(=O)c2ccccc2)C(=O)OC)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H37ClN2O5/c1-3-10-34(40)39(29-19-17-28(37)18-20-29)23-9-24-44-30-21-15-26(16-22-30)25-33(36(42)43-2)38-32-14-8-7-13-31(32)35(41)27-11-5-4-6-12-27/h4-8,11-22,33,38H,3,9-10,23-25H2,1-2H3 |
| InChIKey | OORAGAAGBOAKNA-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.15 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|