C36H38N2O5 — CID 69125941
methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-(3-methyl-N-propanoylanilino)propoxy]phenyl]propanoate (PubChem CID 69125941) has the molecular formula C36H38N2O5 and a molecular weight of 578.71 g/mol. Its IUPAC name is methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-(3-methyl-N-propanoylanilino)propoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-(3-methyl-N-propanoylanilino)propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69125941 |
| Molecular Formula | C36H38N2O5 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | methyl (2S)-2-(2-benzoylanilino)-3-[4-[3-(3-methyl-N-propanoylanilino)propoxy]phenyl]propanoate |
| SMILES | CCC(=O)N(CCCOc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)OC)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C36H38N2O5/c1-4-34(39)38(29-15-10-12-26(2)24-29)22-11-23-43-30-20-18-27(19-21-30)25-33(36(41)42-3)37-32-17-9-8-16-31(32)35(40)28-13-6-5-7-14-28/h5-10,12-21,24,33,37H,4,11,22-23,25H2,1-3H3/t33-/m0/s1 |
| InChIKey | HGGMPEFMDAETRR-XIFFEERXSA-N |
| XLogP | 6.63 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|