C35H36N2O5 — CID 69126265
(2S)-2-(2-benzoylanilino)-3-[4-[2-[3-methyl-N-(2-methylpropanoyl)anilino]ethoxy]phenyl]propanoic acid (PubChem CID 69126265) has the molecular formula C35H36N2O5 and a molecular weight of 564.68 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[2-[3-methyl-N-(2-methylpropanoyl)anilino]ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[3-methyl-N-(2-methylpropanoyl)anilino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69126265 |
| Molecular Formula | C35H36N2O5 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[3-methyl-N-(2-methylpropanoyl)anilino]ethoxy]phenyl]propanoic acid |
| SMILES | Cc1cccc(N(CCOc2ccc(C[C@H](Nc3ccccc3C(=O)c3ccccc3)C(=O)O)cc2)C(=O)C(C)C)c1 |
| InChI | InChI=1S/C35H36N2O5/c1-24(2)34(39)37(28-13-9-10-25(3)22-28)20-21-42-29-18-16-26(17-19-29)23-32(35(40)41)36-31-15-8-7-14-30(31)33(38)27-11-5-4-6-12-27/h4-19,22,24,32,36H,20-21,23H2,1-3H3,(H,40,41)/t32-/m0/s1 |
| InChIKey | NUJRPCULZJERIQ-YTTGMZPUSA-N |
| XLogP | 6.40 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|