C36H40N2O4 — CID 69125797
(2S)-2-(2-benzoylanilino)-3-[4-[3-[3-methyl-N-(2-methylpropyl)anilino]propoxy]phenyl]propanoic acid (PubChem CID 69125797) has the molecular formula C36H40N2O4 and a molecular weight of 564.73 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[3-[3-methyl-N-(2-methylpropyl)anilino]propoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[3-methyl-N-(2-methylpropyl)anilino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69125797 |
| Molecular Formula | C36H40N2O4 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[3-methyl-N-(2-methylpropyl)anilino]propoxy]phenyl]propanoic acid |
| SMILES | Cc1cccc(N(CCCOc2ccc(C[C@H](Nc3ccccc3C(=O)c3ccccc3)C(=O)O)cc2)CC(C)C)c1 |
| InChI | InChI=1S/C36H40N2O4/c1-26(2)25-38(30-14-9-11-27(3)23-30)21-10-22-42-31-19-17-28(18-20-31)24-34(36(40)41)37-33-16-8-7-15-32(33)35(39)29-12-5-4-6-13-29/h4-9,11-20,23,26,34,37H,10,21-22,24-25H2,1-3H3,(H,40,41)/t34-/m0/s1 |
| InChIKey | RHXXGJGSMRZWIY-UMSFTDKQSA-N |
| XLogP | 7.27 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|