C35H33ClN2O5 — CID 69127035
(2S)-2-(2-benzoylanilino)-3-[4-[3-[3-chloro-N-(cyclopropanecarbonyl)anilino]propoxy]phenyl]propanoic acid (PubChem CID 69127035) has the molecular formula C35H33ClN2O5 and a molecular weight of 597.11 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[3-[3-chloro-N-(cyclopropanecarbonyl)anilino]propoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[3-chloro-N-(cyclopropanecarbonyl)anilino]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127035 |
| Molecular Formula | C35H33ClN2O5 |
| Molecular Weight | 597.11 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[3-[3-chloro-N-(cyclopropanecarbonyl)anilino]propoxy]phenyl]propanoic acid |
| SMILES | O=C(c1ccccc1)c1ccccc1N[C@@H](Cc1ccc(OCCCN(C(=O)C2CC2)c2cccc(Cl)c2)cc1)C(=O)O |
| InChI | InChI=1S/C35H33ClN2O5/c36-27-10-6-11-28(23-27)38(34(40)26-16-17-26)20-7-21-43-29-18-14-24(15-19-29)22-32(35(41)42)37-31-13-5-4-12-30(31)33(39)25-8-2-1-3-9-25/h1-6,8-15,18-19,23,26,32,37H,7,16-17,20-22H2,(H,41,42)/t32-/m0/s1 |
| InChIKey | HJDWMHCJHPDHLB-YTTGMZPUSA-N |
| XLogP | 6.89 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.11 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|