C34H31FN2O5 — CID 69125635
2-(2-benzoylanilino)-3-[4-[3-(3-fluoro-N-prop-2-enoylanilino)propoxy]phenyl]propanoic acid (PubChem CID 69125635) has the molecular formula C34H31FN2O5 and a molecular weight of 566.63 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[3-(3-fluoro-N-prop-2-enoylanilino)propoxy]phenyl]propanoic acid.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[3-(3-fluoro-N-prop-2-enoylanilino)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69125635 |
| Molecular Formula | C34H31FN2O5 |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[3-(3-fluoro-N-prop-2-enoylanilino)propoxy]phenyl]propanoic acid |
| SMILES | C=CC(=O)N(CCCOc1ccc(CC(Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C34H31FN2O5/c1-2-32(38)37(27-13-8-12-26(35)23-27)20-9-21-42-28-18-16-24(17-19-28)22-31(34(40)41)36-30-15-7-6-14-29(30)33(39)25-10-4-3-5-11-25/h2-8,10-19,23,31,36H,1,9,20-22H2,(H,40,41) |
| InChIKey | KBQOFFNUPHPFEF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|