C35H36N2O6 — CID 69125912
(2S)-2-(2-benzoylanilino)-3-[4-[2-(N-butanoyl-3-methoxyanilino)ethoxy]phenyl]propanoic acid (PubChem CID 69125912) has the molecular formula C35H36N2O6 and a molecular weight of 580.68 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[2-(N-butanoyl-3-methoxyanilino)ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-(N-butanoyl-3-methoxyanilino)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69125912 |
| Molecular Formula | C35H36N2O6 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-(N-butanoyl-3-methoxyanilino)ethoxy]phenyl]propanoic acid |
| SMILES | CCCC(=O)N(CCOc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1)c1cccc(OC)c1 |
| InChI | InChI=1S/C35H36N2O6/c1-3-10-33(38)37(27-13-9-14-29(24-27)42-2)21-22-43-28-19-17-25(18-20-28)23-32(35(40)41)36-31-16-8-7-15-30(31)34(39)26-11-5-4-6-12-26/h4-9,11-20,24,32,36H,3,10,21-23H2,1-2H3,(H,40,41)/t32-/m0/s1 |
| InChIKey | XIPAYBWVSXWNIW-YTTGMZPUSA-N |
| XLogP | 6.25 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|