C32H38N2O5 — CID 69127402
(2S)-2-(2-benzoylanilino)-3-[4-[2-[2,2-dimethylpropanoyl(propyl)amino]ethoxy]phenyl]propanoic acid (PubChem CID 69127402) has the molecular formula C32H38N2O5 and a molecular weight of 530.67 g/mol. Its IUPAC name is (2S)-2-(2-benzoylanilino)-3-[4-[2-[2,2-dimethylpropanoyl(propyl)amino]ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[2,2-dimethylpropanoyl(propyl)amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 69127402 |
| Molecular Formula | C32H38N2O5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[2,2-dimethylpropanoyl(propyl)amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCCN(CCOc1ccc(C[C@H](Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C32H38N2O5/c1-5-19-34(31(38)32(2,3)4)20-21-39-25-17-15-23(16-18-25)22-28(30(36)37)33-27-14-10-9-13-26(27)29(35)24-11-7-6-8-12-24/h6-18,28,33H,5,19-22H2,1-4H3,(H,36,37)/t28-/m0/s1 |
| InChIKey | JHKZQIQSZALURK-NDEPHWFRSA-N |
| XLogP | 5.69 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|